C13H16Br2ClNO — CID 107941159
2,4-dibromo-N-(1-chloro-4-methylpentan-2-yl)benzamide (PubChem CID 107941159) has the molecular formula C13H16Br2ClNO and a molecular weight of 397.54 g/mol. Its IUPAC name is 2,4-dibromo-N-(1-chloro-4-methylpentan-2-yl)benzamide.
| Compound Name | 2,4-dibromo-N-(1-chloro-4-methylpentan-2-yl)benzamide |
|---|---|
| PubChem CID | 107941159 |
| Molecular Formula | C13H16Br2ClNO |
| Molecular Weight | 397.54 g/mol |
| Exact Mass | 394.93 |
| IUPAC Name | 2,4-dibromo-N-(1-chloro-4-methylpentan-2-yl)benzamide |
| SMILES | CC(C)CC(CCl)NC(=O)c1ccc(Br)cc1Br |
| InChI | InChI=1S/C13H16Br2ClNO/c1-8(2)5-10(7-16)17-13(18)11-4-3-9(14)6-12(11)15/h3-4,6,8,10H,5,7H2,1-2H3,(H,17,18) |
| InChIKey | PGANWUUJYPQBEC-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.54 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|