C14H19Cl2NOS — CID 113272456
2-chloro-N-(1-chloro-4-methylpentan-2-yl)-5-methylsulfanylbenzamide (PubChem CID 113272456) has the molecular formula C14H19Cl2NOS and a molecular weight of 320.29 g/mol. Its IUPAC name is 2-chloro-N-(1-chloro-4-methylpentan-2-yl)-5-methylsulfanylbenzamide.
| Compound Name | 2-chloro-N-(1-chloro-4-methylpentan-2-yl)-5-methylsulfanylbenzamide |
|---|---|
| PubChem CID | 113272456 |
| Molecular Formula | C14H19Cl2NOS |
| Molecular Weight | 320.29 g/mol |
| Exact Mass | 319.06 |
| IUPAC Name | 2-chloro-N-(1-chloro-4-methylpentan-2-yl)-5-methylsulfanylbenzamide |
| SMILES | CSc1ccc(Cl)c(C(=O)NC(CCl)CC(C)C)c1 |
| InChI | InChI=1S/C14H19Cl2NOS/c1-9(2)6-10(8-15)17-14(18)12-7-11(19-3)4-5-13(12)16/h4-5,7,9-10H,6,8H2,1-3H3,(H,17,18) |
| InChIKey | QJQMKMKYQCWHMZ-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.29 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|