About 2-propoxy-3-(2,2,2-trifluoroethoxy)cyclobutan-1-one
2-propoxy-3-(2,2,2-trifluoroethoxy)cyclobutan-1-one (PubChem CID 107942238) has the molecular formula C9H13F3O3
and a molecular weight of 226.19 g/mol. Its IUPAC name is 2-propoxy-3-(2,2,2-trifluoroethoxy)cyclobutan-1-one.
Molecular Properties
| Compound Name | 2-propoxy-3-(2,2,2-trifluoroethoxy)cyclobutan-1-one |
| PubChem CID | 107942238 |
| Molecular Formula | C9H13F3O3 |
| Molecular Weight | 226.19 g/mol |
| Exact Mass | 226.08 |
| IUPAC Name | 2-propoxy-3-(2,2,2-trifluoroethoxy)cyclobutan-1-one |
| SMILES | CCCOC1C(=O)CC1OCC(F)(F)F |
| InChI | InChI=1S/C9H13F3O3/c1-2-3-14-8-6(13)4-7(8)15-5-9(10,11)12/h7-8H,2-5H2,1H3 |
| InChIKey | IMRSHHRWENWPLH-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.19 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-propoxy-3-(2,2,2-trifluoroethoxy)cyclobutan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-propoxy-3-(2,2,2-trifluoroethoxy)cyclobutan-1-one?
The IUPAC name of 2-propoxy-3-(2,2,2-trifluoroethoxy)cyclobutan-1-one (CID 107942238) is 2-propoxy-3-(2,2,2-trifluoroethoxy)cyclobutan-1-one.
What is the SMILES notation for 2-propoxy-3-(2,2,2-trifluoroethoxy)cyclobutan-1-one?
The canonical SMILES for 2-propoxy-3-(2,2,2-trifluoroethoxy)cyclobutan-1-one is CCCOC1C(=O)CC1OCC(F)(F)F.
What is the InChIKey of 2-propoxy-3-(2,2,2-trifluoroethoxy)cyclobutan-1-one?
The InChIKey is IMRSHHRWENWPLH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13F3O3/c1-2-3-14-8-6(13)4-7(8)15-5-9(10,11)12/h7-8H,2-5H2,1H3.
What are the key properties of 2-propoxy-3-(2,2,2-trifluoroethoxy)cyclobutan-1-one?
2-propoxy-3-(2,2,2-trifluoroethoxy)cyclobutan-1-one has a molecular weight of 226.19 g/mol, XLogP of 1.70, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-propoxy-3-(2,2,2-trifluoroethoxy)cyclobutan-1-one is sourced from PubChem (CID 107942238), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).