C15H26O3 — CID 114018828
3-(3,4-dimethylcyclohexyl)oxy-2-propoxycyclobutan-1-one (PubChem CID 114018828) has the molecular formula C15H26O3 and a molecular weight of 254.37 g/mol. Its IUPAC name is 3-(3,4-dimethylcyclohexyl)oxy-2-propoxycyclobutan-1-one.
| Compound Name | 3-(3,4-dimethylcyclohexyl)oxy-2-propoxycyclobutan-1-one |
|---|---|
| PubChem CID | 114018828 |
| Molecular Formula | C15H26O3 |
| Molecular Weight | 254.37 g/mol |
| Exact Mass | 254.19 |
| IUPAC Name | 3-(3,4-dimethylcyclohexyl)oxy-2-propoxycyclobutan-1-one |
| SMILES | CCCOC1C(=O)CC1OC1CCC(C)C(C)C1 |
| InChI | InChI=1S/C15H26O3/c1-4-7-17-15-13(16)9-14(15)18-12-6-5-10(2)11(3)8-12/h10-12,14-15H,4-9H2,1-3H3 |
| InChIKey | JBBWGFLHOQDUMV-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.37 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |