C13H14BrClF2O2 — CID 107943140
5-bromo-1-(3-chloro-2-propoxycyclobutyl)oxy-2,3-difluorobenzene (PubChem CID 107943140) has the molecular formula C13H14BrClF2O2 and a molecular weight of 355.61 g/mol. Its IUPAC name is 5-bromo-1-(3-chloro-2-propoxycyclobutyl)oxy-2,3-difluorobenzene.
| Compound Name | 5-bromo-1-(3-chloro-2-propoxycyclobutyl)oxy-2,3-difluorobenzene |
|---|---|
| PubChem CID | 107943140 |
| Molecular Formula | C13H14BrClF2O2 |
| Molecular Weight | 355.61 g/mol |
| Exact Mass | 353.98 |
| IUPAC Name | 5-bromo-1-(3-chloro-2-propoxycyclobutyl)oxy-2,3-difluorobenzene |
| SMILES | CCCOC1C(Cl)CC1Oc1cc(Br)cc(F)c1F |
| InChI | InChI=1S/C13H14BrClF2O2/c1-2-3-18-13-8(15)6-11(13)19-10-5-7(14)4-9(16)12(10)17/h4-5,8,11,13H,2-3,6H2,1H3 |
| InChIKey | TXJUSGINACFULV-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.61 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|