C10H19N3O2 — CID 107944033
[5-(propoxymethyl)-4-propyl-1,2,4-triazol-3-yl]methanol (PubChem CID 107944033) has the molecular formula C10H19N3O2 and a molecular weight of 213.28 g/mol. Its IUPAC name is [5-(propoxymethyl)-4-propyl-1,2,4-triazol-3-yl]methanol.
| Compound Name | [5-(propoxymethyl)-4-propyl-1,2,4-triazol-3-yl]methanol |
|---|---|
| PubChem CID | 107944033 |
| Molecular Formula | C10H19N3O2 |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.15 |
| IUPAC Name | [5-(propoxymethyl)-4-propyl-1,2,4-triazol-3-yl]methanol |
| SMILES | CCCOCc1nnc(CO)n1CCC |
| InChI | InChI=1S/C10H19N3O2/c1-3-5-13-9(7-14)11-12-10(13)8-15-6-4-2/h14H,3-8H2,1-2H3 |
| InChIKey | ZCSFDTZVWAHRJT-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|