C10H19N3O — CID 115396823
(5-butan-2-yl-4-propyl-1,2,4-triazol-3-yl)methanol (PubChem CID 115396823) has the molecular formula C10H19N3O and a molecular weight of 197.28 g/mol. Its IUPAC name is (5-butan-2-yl-4-propyl-1,2,4-triazol-3-yl)methanol.
| Compound Name | (5-butan-2-yl-4-propyl-1,2,4-triazol-3-yl)methanol |
|---|---|
| PubChem CID | 115396823 |
| Molecular Formula | C10H19N3O |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.15 |
| IUPAC Name | (5-butan-2-yl-4-propyl-1,2,4-triazol-3-yl)methanol |
| SMILES | CCCn1c(CO)nnc1C(C)CC |
| InChI | InChI=1S/C10H19N3O/c1-4-6-13-9(7-14)11-12-10(13)8(3)5-2/h8,14H,4-7H2,1-3H3 |
| InChIKey | VIKGFIONWMXANM-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |