C12H10Br2N2O — CID 107944306
(2,4-dibromophenyl)-(1-ethylpyrazol-4-yl)methanone (PubChem CID 107944306) has the molecular formula C12H10Br2N2O and a molecular weight of 358.03 g/mol. Its IUPAC name is (2,4-dibromophenyl)-(1-ethylpyrazol-4-yl)methanone.
| Compound Name | (2,4-dibromophenyl)-(1-ethylpyrazol-4-yl)methanone |
|---|---|
| PubChem CID | 107944306 |
| Molecular Formula | C12H10Br2N2O |
| Molecular Weight | 358.03 g/mol |
| Exact Mass | 355.92 |
| IUPAC Name | (2,4-dibromophenyl)-(1-ethylpyrazol-4-yl)methanone |
| SMILES | CCn1cc(C(=O)c2ccc(Br)cc2Br)cn1 |
| InChI | InChI=1S/C12H10Br2N2O/c1-2-16-7-8(6-15-16)12(17)10-4-3-9(13)5-11(10)14/h3-7H,2H2,1H3 |
| InChIKey | HCEMLFWAWZLVIN-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.03 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |