C12H9F3N2O — CID 114964425
(1-ethylpyrazol-4-yl)-(2,3,4-trifluorophenyl)methanone (PubChem CID 114964425) has the molecular formula C12H9F3N2O and a molecular weight of 254.21 g/mol. Its IUPAC name is (1-ethylpyrazol-4-yl)-(2,3,4-trifluorophenyl)methanone.
| Compound Name | (1-ethylpyrazol-4-yl)-(2,3,4-trifluorophenyl)methanone |
|---|---|
| PubChem CID | 114964425 |
| Molecular Formula | C12H9F3N2O |
| Molecular Weight | 254.21 g/mol |
| Exact Mass | 254.07 |
| IUPAC Name | (1-ethylpyrazol-4-yl)-(2,3,4-trifluorophenyl)methanone |
| SMILES | CCn1cc(C(=O)c2ccc(F)c(F)c2F)cn1 |
| InChI | InChI=1S/C12H9F3N2O/c1-2-17-6-7(5-16-17)12(18)8-3-4-9(13)11(15)10(8)14/h3-6H,2H2,1H3 |
| InChIKey | QMUGNALXVLIOOU-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.21 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|