C11H12Br2O3S — CID 107944317
1-(2,4-dibromophenyl)-4-methylsulfonylbutan-1-one (PubChem CID 107944317) has the molecular formula C11H12Br2O3S and a molecular weight of 384.09 g/mol. Its IUPAC name is 1-(2,4-dibromophenyl)-4-methylsulfonylbutan-1-one.
| Compound Name | 1-(2,4-dibromophenyl)-4-methylsulfonylbutan-1-one |
|---|---|
| PubChem CID | 107944317 |
| Molecular Formula | C11H12Br2O3S |
| Molecular Weight | 384.09 g/mol |
| Exact Mass | 381.89 |
| IUPAC Name | 1-(2,4-dibromophenyl)-4-methylsulfonylbutan-1-one |
| SMILES | CS(=O)(=O)CCCC(=O)c1ccc(Br)cc1Br |
| InChI | InChI=1S/C11H12Br2O3S/c1-17(15,16)6-2-3-11(14)9-5-4-8(12)7-10(9)13/h4-5,7H,2-3,6H2,1H3 |
| InChIKey | MBWCADMSICQKHT-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.09 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |