C11H10Br2O — CID 107944518
1-(2,4-dibromophenyl)pent-4-en-1-one (PubChem CID 107944518) has the molecular formula C11H10Br2O and a molecular weight of 318.01 g/mol. Its IUPAC name is 1-(2,4-dibromophenyl)pent-4-en-1-one.
| Compound Name | 1-(2,4-dibromophenyl)pent-4-en-1-one |
|---|---|
| PubChem CID | 107944518 |
| Molecular Formula | C11H10Br2O |
| Molecular Weight | 318.01 g/mol |
| Exact Mass | 315.91 |
| IUPAC Name | 1-(2,4-dibromophenyl)pent-4-en-1-one |
| SMILES | C=CCCC(=O)c1ccc(Br)cc1Br |
| InChI | InChI=1S/C11H10Br2O/c1-2-3-4-11(14)9-6-5-8(12)7-10(9)13/h2,5-7H,1,3-4H2 |
| InChIKey | RMIDTKRDYQYAGK-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.01 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|