C14H12Br2FN — CID 107945033
1-(2,4-dibromophenyl)-1-(4-fluorophenyl)-N-methylmethanamine (PubChem CID 107945033) has the molecular formula C14H12Br2FN and a molecular weight of 373.06 g/mol. Its IUPAC name is 1-(2,4-dibromophenyl)-1-(4-fluorophenyl)-N-methylmethanamine.
| Compound Name | 1-(2,4-dibromophenyl)-1-(4-fluorophenyl)-N-methylmethanamine |
|---|---|
| PubChem CID | 107945033 |
| Molecular Formula | C14H12Br2FN |
| Molecular Weight | 373.06 g/mol |
| Exact Mass | 370.93 |
| IUPAC Name | 1-(2,4-dibromophenyl)-1-(4-fluorophenyl)-N-methylmethanamine |
| SMILES | CNC(c1ccc(F)cc1)c1ccc(Br)cc1Br |
| InChI | InChI=1S/C14H12Br2FN/c1-18-14(9-2-5-11(17)6-3-9)12-7-4-10(15)8-13(12)16/h2-8,14,18H,1H3 |
| InChIKey | KRXPLKKDRPMZAO-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.06 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |