C16H17BrClN — CID 107945076
1-(3-bromo-5-chlorophenyl)-N-methyl-2-(3-methylphenyl)ethanamine (PubChem CID 107945076) has the molecular formula C16H17BrClN and a molecular weight of 338.68 g/mol. Its IUPAC name is 1-(3-bromo-5-chlorophenyl)-N-methyl-2-(3-methylphenyl)ethanamine.
| Compound Name | 1-(3-bromo-5-chlorophenyl)-N-methyl-2-(3-methylphenyl)ethanamine |
|---|---|
| PubChem CID | 107945076 |
| Molecular Formula | C16H17BrClN |
| Molecular Weight | 338.68 g/mol |
| Exact Mass | 337.02 |
| IUPAC Name | 1-(3-bromo-5-chlorophenyl)-N-methyl-2-(3-methylphenyl)ethanamine |
| SMILES | CNC(Cc1cccc(C)c1)c1cc(Cl)cc(Br)c1 |
| InChI | InChI=1S/C16H17BrClN/c1-11-4-3-5-12(6-11)7-16(19-2)13-8-14(17)10-15(18)9-13/h3-6,8-10,16,19H,7H2,1-2H3 |
| InChIKey | WCQQVBMQZASOGH-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.68 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |