C16H16Br2ClN — CID 107945231
N-[(3-chlorophenyl)-(2,4-dibromophenyl)methyl]propan-1-amine (PubChem CID 107945231) has the molecular formula C16H16Br2ClN and a molecular weight of 417.57 g/mol. Its IUPAC name is N-[(3-chlorophenyl)-(2,4-dibromophenyl)methyl]propan-1-amine.
| Compound Name | N-[(3-chlorophenyl)-(2,4-dibromophenyl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 107945231 |
| Molecular Formula | C16H16Br2ClN |
| Molecular Weight | 417.57 g/mol |
| Exact Mass | 414.93 |
| IUPAC Name | N-[(3-chlorophenyl)-(2,4-dibromophenyl)methyl]propan-1-amine |
| SMILES | CCCNC(c1cccc(Cl)c1)c1ccc(Br)cc1Br |
| InChI | InChI=1S/C16H16Br2ClN/c1-2-8-20-16(11-4-3-5-13(19)9-11)14-7-6-12(17)10-15(14)18/h3-7,9-10,16,20H,2,8H2,1H3 |
| InChIKey | YKHOQHYUEZXBQP-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.57 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |