C17H20ClN — CID 60819696
N-[(3-chlorophenyl)-(2-methylphenyl)methyl]propan-1-amine (PubChem CID 60819696) has the molecular formula C17H20ClN and a molecular weight of 273.81 g/mol. Its IUPAC name is N-[(3-chlorophenyl)-(2-methylphenyl)methyl]propan-1-amine.
| Compound Name | N-[(3-chlorophenyl)-(2-methylphenyl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 60819696 |
| Molecular Formula | C17H20ClN |
| Molecular Weight | 273.81 g/mol |
| Exact Mass | 273.13 |
| IUPAC Name | N-[(3-chlorophenyl)-(2-methylphenyl)methyl]propan-1-amine |
| SMILES | CCCNC(c1cccc(Cl)c1)c1ccccc1C |
| InChI | InChI=1S/C17H20ClN/c1-3-11-19-17(14-8-6-9-15(18)12-14)16-10-5-4-7-13(16)2/h4-10,12,17,19H,3,11H2,1-2H3 |
| InChIKey | WRTUZBKUXZUADA-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.81 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |