C11H13BrClN — CID 107946193
1-(3-bromo-5-chlorophenyl)-N-ethylprop-2-en-1-amine (PubChem CID 107946193) has the molecular formula C11H13BrClN and a molecular weight of 274.59 g/mol. Its IUPAC name is 1-(3-bromo-5-chlorophenyl)-N-ethylprop-2-en-1-amine.
| Compound Name | 1-(3-bromo-5-chlorophenyl)-N-ethylprop-2-en-1-amine |
|---|---|
| PubChem CID | 107946193 |
| Molecular Formula | C11H13BrClN |
| Molecular Weight | 274.59 g/mol |
| Exact Mass | 272.99 |
| IUPAC Name | 1-(3-bromo-5-chlorophenyl)-N-ethylprop-2-en-1-amine |
| SMILES | C=CC(NCC)c1cc(Cl)cc(Br)c1 |
| InChI | InChI=1S/C11H13BrClN/c1-3-11(14-4-2)8-5-9(12)7-10(13)6-8/h3,5-7,11,14H,1,4H2,2H3 |
| InChIKey | MFASOLTXIOXPFM-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.59 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|