C14H16BrFN2OS — CID 107951244
N-(2-amino-2-sulfanylideneethyl)-3-bromo-N-cyclopentyl-2-fluorobenzamide (PubChem CID 107951244) has the molecular formula C14H16BrFN2OS and a molecular weight of 359.26 g/mol. Its IUPAC name is N-(2-amino-2-sulfanylideneethyl)-3-bromo-N-cyclopentyl-2-fluorobenzamide.
| Compound Name | N-(2-amino-2-sulfanylideneethyl)-3-bromo-N-cyclopentyl-2-fluorobenzamide |
|---|---|
| PubChem CID | 107951244 |
| Molecular Formula | C14H16BrFN2OS |
| Molecular Weight | 359.26 g/mol |
| Exact Mass | 358.02 |
| IUPAC Name | N-(2-amino-2-sulfanylideneethyl)-3-bromo-N-cyclopentyl-2-fluorobenzamide |
| SMILES | NC(=S)CN(C(=O)c1cccc(Br)c1F)C1CCCC1 |
| InChI | InChI=1S/C14H16BrFN2OS/c15-11-7-3-6-10(13(11)16)14(19)18(8-12(17)20)9-4-1-2-5-9/h3,6-7,9H,1-2,4-5,8H2,(H2,17,20) |
| InChIKey | JHSRHOZLDFENGO-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.26 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|