C12H14Cl2N2OS2 — CID 107961828
N-(2-amino-2-sulfanylideneethyl)-2,5-dichloro-N-cyclopentylthiophene-3-carboxamide (PubChem CID 107961828) has the molecular formula C12H14Cl2N2OS2 and a molecular weight of 337.30 g/mol. Its IUPAC name is N-(2-amino-2-sulfanylideneethyl)-2,5-dichloro-N-cyclopentylthiophene-3-carboxamide.
| Compound Name | N-(2-amino-2-sulfanylideneethyl)-2,5-dichloro-N-cyclopentylthiophene-3-carboxamide |
|---|---|
| PubChem CID | 107961828 |
| Molecular Formula | C12H14Cl2N2OS2 |
| Molecular Weight | 337.30 g/mol |
| Exact Mass | 335.99 |
| IUPAC Name | N-(2-amino-2-sulfanylideneethyl)-2,5-dichloro-N-cyclopentylthiophene-3-carboxamide |
| SMILES | NC(=S)CN(C(=O)c1cc(Cl)sc1Cl)C1CCCC1 |
| InChI | InChI=1S/C12H14Cl2N2OS2/c13-9-5-8(11(14)19-9)12(17)16(6-10(15)18)7-3-1-2-4-7/h5,7H,1-4,6H2,(H2,15,18) |
| InChIKey | GSDZXTWJMYXPNL-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.30 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|