C14H16BrFN2O2 — CID 107952761
2-[5-(3-bromo-4-fluorophenyl)-1,3-oxazol-2-yl]-N-(2-methoxyethyl)ethanamine (PubChem CID 107952761) has the molecular formula C14H16BrFN2O2 and a molecular weight of 343.20 g/mol. Its IUPAC name is 2-[5-(3-bromo-4-fluorophenyl)-1,3-oxazol-2-yl]-N-(2-methoxyethyl)ethanamine.
| Compound Name | 2-[5-(3-bromo-4-fluorophenyl)-1,3-oxazol-2-yl]-N-(2-methoxyethyl)ethanamine |
|---|---|
| PubChem CID | 107952761 |
| Molecular Formula | C14H16BrFN2O2 |
| Molecular Weight | 343.20 g/mol |
| Exact Mass | 342.04 |
| IUPAC Name | 2-[5-(3-bromo-4-fluorophenyl)-1,3-oxazol-2-yl]-N-(2-methoxyethyl)ethanamine |
| SMILES | COCCNCCc1ncc(-c2ccc(F)c(Br)c2)o1 |
| InChI | InChI=1S/C14H16BrFN2O2/c1-19-7-6-17-5-4-14-18-9-13(20-14)10-2-3-12(16)11(15)8-10/h2-3,8-9,17H,4-7H2,1H3 |
| InChIKey | CDWOPNYLBRCQGS-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 47.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.20 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|