C14H16F2N2O2 — CID 65182376
2-[5-(2,5-difluorophenyl)-1,3-oxazol-2-yl]-N-(2-methoxyethyl)ethanamine (PubChem CID 65182376) has the molecular formula C14H16F2N2O2 and a molecular weight of 282.29 g/mol. Its IUPAC name is 2-[5-(2,5-difluorophenyl)-1,3-oxazol-2-yl]-N-(2-methoxyethyl)ethanamine.
| Compound Name | 2-[5-(2,5-difluorophenyl)-1,3-oxazol-2-yl]-N-(2-methoxyethyl)ethanamine |
|---|---|
| PubChem CID | 65182376 |
| Molecular Formula | C14H16F2N2O2 |
| Molecular Weight | 282.29 g/mol |
| Exact Mass | 282.12 |
| IUPAC Name | 2-[5-(2,5-difluorophenyl)-1,3-oxazol-2-yl]-N-(2-methoxyethyl)ethanamine |
| SMILES | COCCNCCc1ncc(-c2cc(F)ccc2F)o1 |
| InChI | InChI=1S/C14H16F2N2O2/c1-19-7-6-17-5-4-14-18-9-13(20-14)11-8-10(15)2-3-12(11)16/h2-3,8-9,17H,4-7H2,1H3 |
| InChIKey | BQZRUXSEYWKODS-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 47.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.29 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|