C17H11Br2ClO — CID 107955684
(4-chloronaphthalen-1-yl)-(2,4-dibromophenyl)methanol (PubChem CID 107955684) has the molecular formula C17H11Br2ClO and a molecular weight of 426.54 g/mol. Its IUPAC name is (4-chloronaphthalen-1-yl)-(2,4-dibromophenyl)methanol.
| Compound Name | (4-chloronaphthalen-1-yl)-(2,4-dibromophenyl)methanol |
|---|---|
| PubChem CID | 107955684 |
| Molecular Formula | C17H11Br2ClO |
| Molecular Weight | 426.54 g/mol |
| Exact Mass | 423.89 |
| IUPAC Name | (4-chloronaphthalen-1-yl)-(2,4-dibromophenyl)methanol |
| SMILES | OC(c1ccc(Br)cc1Br)c1ccc(Cl)c2ccccc12 |
| InChI | InChI=1S/C17H11Br2ClO/c18-10-5-6-14(15(19)9-10)17(21)13-7-8-16(20)12-4-2-1-3-11(12)13/h1-9,17,21H |
| InChIKey | MVGXCMVOZVGPKN-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.54 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |