C17H11BrCl2O — CID 79590685
(4-bromonaphthalen-1-yl)-(2,3-dichlorophenyl)methanol (PubChem CID 79590685) has the molecular formula C17H11BrCl2O and a molecular weight of 382.08 g/mol. Its IUPAC name is (4-bromonaphthalen-1-yl)-(2,3-dichlorophenyl)methanol.
| Compound Name | (4-bromonaphthalen-1-yl)-(2,3-dichlorophenyl)methanol |
|---|---|
| PubChem CID | 79590685 |
| Molecular Formula | C17H11BrCl2O |
| Molecular Weight | 382.08 g/mol |
| Exact Mass | 379.94 |
| IUPAC Name | (4-bromonaphthalen-1-yl)-(2,3-dichlorophenyl)methanol |
| SMILES | OC(c1cccc(Cl)c1Cl)c1ccc(Br)c2ccccc12 |
| InChI | InChI=1S/C17H11BrCl2O/c18-14-9-8-12(10-4-1-2-5-11(10)14)17(21)13-6-3-7-15(19)16(13)20/h1-9,17,21H |
| InChIKey | TZXXUMSUKNWWEI-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.08 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |