C15H11Cl2NO — CID 115351822
(2,3-dichlorophenyl)-(1H-indol-4-yl)methanol (PubChem CID 115351822) has the molecular formula C15H11Cl2NO and a molecular weight of 292.17 g/mol. Its IUPAC name is (2,3-dichlorophenyl)-(1H-indol-4-yl)methanol.
| Compound Name | (2,3-dichlorophenyl)-(1H-indol-4-yl)methanol |
|---|---|
| PubChem CID | 115351822 |
| Molecular Formula | C15H11Cl2NO |
| Molecular Weight | 292.17 g/mol |
| Exact Mass | 291.02 |
| IUPAC Name | (2,3-dichlorophenyl)-(1H-indol-4-yl)methanol |
| SMILES | OC(c1cccc(Cl)c1Cl)c1cccc2[nH]ccc12 |
| InChI | InChI=1S/C15H11Cl2NO/c16-12-5-1-4-11(14(12)17)15(19)10-3-2-6-13-9(10)7-8-18-13/h1-8,15,18-19H |
| InChIKey | UAEWABVRTJXHQE-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 36.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.17 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |