C17H12BrCl2N — CID 79589877
(4-bromonaphthalen-1-yl)-(2,3-dichlorophenyl)methanamine (PubChem CID 79589877) has the molecular formula C17H12BrCl2N and a molecular weight of 381.10 g/mol. Its IUPAC name is (4-bromonaphthalen-1-yl)-(2,3-dichlorophenyl)methanamine.
| Compound Name | (4-bromonaphthalen-1-yl)-(2,3-dichlorophenyl)methanamine |
|---|---|
| PubChem CID | 79589877 |
| Molecular Formula | C17H12BrCl2N |
| Molecular Weight | 381.10 g/mol |
| Exact Mass | 378.95 |
| IUPAC Name | (4-bromonaphthalen-1-yl)-(2,3-dichlorophenyl)methanamine |
| SMILES | NC(c1cccc(Cl)c1Cl)c1ccc(Br)c2ccccc12 |
| InChI | InChI=1S/C17H12BrCl2N/c18-14-9-8-12(10-4-1-2-5-11(10)14)17(21)13-6-3-7-15(19)16(13)20/h1-9,17H,21H2 |
| InChIKey | KLJGAHXWWUDRRE-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.10 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |