C19H18BrN — CID 79589901
(4-bromonaphthalen-1-yl)-(3,5-dimethylphenyl)methanamine (PubChem CID 79589901) has the molecular formula C19H18BrN and a molecular weight of 340.26 g/mol. Its IUPAC name is (4-bromonaphthalen-1-yl)-(3,5-dimethylphenyl)methanamine.
| Compound Name | (4-bromonaphthalen-1-yl)-(3,5-dimethylphenyl)methanamine |
|---|---|
| PubChem CID | 79589901 |
| Molecular Formula | C19H18BrN |
| Molecular Weight | 340.26 g/mol |
| Exact Mass | 339.06 |
| IUPAC Name | (4-bromonaphthalen-1-yl)-(3,5-dimethylphenyl)methanamine |
| SMILES | Cc1cc(C)cc(C(N)c2ccc(Br)c3ccccc23)c1 |
| InChI | InChI=1S/C19H18BrN/c1-12-9-13(2)11-14(10-12)19(21)17-7-8-18(20)16-6-4-3-5-15(16)17/h3-11,19H,21H2,1-2H3 |
| InChIKey | MMRRYOCNCPBVES-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.26 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |