C12H12BrFN2O — CID 107956016
N-(3-azabicyclo[3.1.0]hexan-6-yl)-3-bromo-4-fluorobenzamide (PubChem CID 107956016) has the molecular formula C12H12BrFN2O and a molecular weight of 299.14 g/mol. Its IUPAC name is N-(3-azabicyclo[3.1.0]hexan-6-yl)-3-bromo-4-fluorobenzamide.
| Compound Name | N-(3-azabicyclo[3.1.0]hexan-6-yl)-3-bromo-4-fluorobenzamide |
|---|---|
| PubChem CID | 107956016 |
| Molecular Formula | C12H12BrFN2O |
| Molecular Weight | 299.14 g/mol |
| Exact Mass | 298.01 |
| IUPAC Name | N-(3-azabicyclo[3.1.0]hexan-6-yl)-3-bromo-4-fluorobenzamide |
| SMILES | O=C(NC1C2CNCC21)c1ccc(F)c(Br)c1 |
| InChI | InChI=1S/C12H12BrFN2O/c13-9-3-6(1-2-10(9)14)12(17)16-11-7-4-15-5-8(7)11/h1-3,7-8,11,15H,4-5H2,(H,16,17) |
| InChIKey | FDNCOUAEFCVJLN-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.14 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |