C27H20N2O4 — CID 1079566
[4-[[2-methyl-3-(5-methyl-1,3-benzoxazol-2-yl)phenyl]iminomethyl]phenyl] furan-2-carboxylate (PubChem CID 1079566) has the molecular formula C27H20N2O4 and a molecular weight of 436.47 g/mol. Its IUPAC name is [4-[[2-methyl-3-(5-methyl-1,3-benzoxazol-2-yl)phenyl]iminomethyl]phenyl] furan-2-carboxylate.
| Compound Name | [4-[[2-methyl-3-(5-methyl-1,3-benzoxazol-2-yl)phenyl]iminomethyl]phenyl] furan-2-carboxylate |
|---|---|
| PubChem CID | 1079566 |
| Molecular Formula | C27H20N2O4 |
| Molecular Weight | 436.47 g/mol |
| Exact Mass | 436.14 |
| IUPAC Name | [4-[[2-methyl-3-(5-methyl-1,3-benzoxazol-2-yl)phenyl]iminomethyl]phenyl] furan-2-carboxylate |
| SMILES | Cc1ccc2oc(-c3cccc(/N=C/c4ccc(OC(=O)c5ccco5)cc4)c3C)nc2c1 |
| InChI | InChI=1S/C27H20N2O4/c1-17-8-13-24-23(15-17)29-26(33-24)21-5-3-6-22(18(21)2)28-16-19-9-11-20(12-10-19)32-27(30)25-7-4-14-31-25/h3-16H,1-2H3/b28-16+ |
| InChIKey | LJEOQQZUIRIEJU-LQKURTRISA-N |
| XLogP | 6.67 |
| TPSA | 77.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.47 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|