C10H7BrClFN2S — CID 107958082
2-(3-bromo-4-fluorophenyl)-5-(1-chloroethyl)-1,3,4-thiadiazole (PubChem CID 107958082) has the molecular formula C10H7BrClFN2S and a molecular weight of 321.60 g/mol. Its IUPAC name is 2-(3-bromo-4-fluorophenyl)-5-(1-chloroethyl)-1,3,4-thiadiazole.
| Compound Name | 2-(3-bromo-4-fluorophenyl)-5-(1-chloroethyl)-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 107958082 |
| Molecular Formula | C10H7BrClFN2S |
| Molecular Weight | 321.60 g/mol |
| Exact Mass | 319.92 |
| IUPAC Name | 2-(3-bromo-4-fluorophenyl)-5-(1-chloroethyl)-1,3,4-thiadiazole |
| SMILES | CC(Cl)c1nnc(-c2ccc(F)c(Br)c2)s1 |
| InChI | InChI=1S/C10H7BrClFN2S/c1-5(12)9-14-15-10(16-9)6-2-3-8(13)7(11)4-6/h2-5H,1H3 |
| InChIKey | WYPTXHDMBHDPME-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.60 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|