C14H10BrNO2S — CID 107960058
7-(5-bromothiophene-3-carbonyl)-3,4-dihydro-2H-isoquinolin-1-one (PubChem CID 107960058) has the molecular formula C14H10BrNO2S and a molecular weight of 336.21 g/mol. Its IUPAC name is 7-(5-bromothiophene-3-carbonyl)-3,4-dihydro-2H-isoquinolin-1-one.
| Compound Name | 7-(5-bromothiophene-3-carbonyl)-3,4-dihydro-2H-isoquinolin-1-one |
|---|---|
| PubChem CID | 107960058 |
| Molecular Formula | C14H10BrNO2S |
| Molecular Weight | 336.21 g/mol |
| Exact Mass | 334.96 |
| IUPAC Name | 7-(5-bromothiophene-3-carbonyl)-3,4-dihydro-2H-isoquinolin-1-one |
| SMILES | O=C(c1csc(Br)c1)c1ccc2c(c1)C(=O)NCC2 |
| InChI | InChI=1S/C14H10BrNO2S/c15-12-6-10(7-19-12)13(17)9-2-1-8-3-4-16-14(18)11(8)5-9/h1-2,5-7H,3-4H2,(H,16,18) |
| InChIKey | JTPSUVUDVHHLBY-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.21 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |