C14H16BrNO2 — CID 113422785
8-(2-bromobutanoyl)-2,3,4,5-tetrahydro-2-benzazepin-1-one (PubChem CID 113422785) has the molecular formula C14H16BrNO2 and a molecular weight of 310.19 g/mol. Its IUPAC name is 8-(2-bromobutanoyl)-2,3,4,5-tetrahydro-2-benzazepin-1-one.
| Compound Name | 8-(2-bromobutanoyl)-2,3,4,5-tetrahydro-2-benzazepin-1-one |
|---|---|
| PubChem CID | 113422785 |
| Molecular Formula | C14H16BrNO2 |
| Molecular Weight | 310.19 g/mol |
| Exact Mass | 309.04 |
| IUPAC Name | 8-(2-bromobutanoyl)-2,3,4,5-tetrahydro-2-benzazepin-1-one |
| SMILES | CCC(Br)C(=O)c1ccc2c(c1)C(=O)NCCC2 |
| InChI | InChI=1S/C14H16BrNO2/c1-2-12(15)13(17)10-6-5-9-4-3-7-16-14(18)11(9)8-10/h5-6,8,12H,2-4,7H2,1H3,(H,16,18) |
| InChIKey | MCOBSAPEWMFLPP-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.19 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|