C16H21NO2 — CID 104525386
8-(2-methylpentanoyl)-2,3,4,5-tetrahydro-2-benzazepin-1-one (PubChem CID 104525386) has the molecular formula C16H21NO2 and a molecular weight of 259.35 g/mol. Its IUPAC name is 8-(2-methylpentanoyl)-2,3,4,5-tetrahydro-2-benzazepin-1-one.
| Compound Name | 8-(2-methylpentanoyl)-2,3,4,5-tetrahydro-2-benzazepin-1-one |
|---|---|
| PubChem CID | 104525386 |
| Molecular Formula | C16H21NO2 |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.16 |
| IUPAC Name | 8-(2-methylpentanoyl)-2,3,4,5-tetrahydro-2-benzazepin-1-one |
| SMILES | CCCC(C)C(=O)c1ccc2c(c1)C(=O)NCCC2 |
| InChI | InChI=1S/C16H21NO2/c1-3-5-11(2)15(18)13-8-7-12-6-4-9-17-16(19)14(12)10-13/h7-8,10-11H,3-6,9H2,1-2H3,(H,17,19) |
| InChIKey | BOJWOHXJJKZPLO-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |