C12H4Br2ClFN2S — CID 107960345
4-chloro-2-(2,5-dibromothiophen-3-yl)-7-fluoroquinazoline (PubChem CID 107960345) has the molecular formula C12H4Br2ClFN2S and a molecular weight of 422.50 g/mol. Its IUPAC name is 4-chloro-2-(2,5-dibromothiophen-3-yl)-7-fluoroquinazoline.
| Compound Name | 4-chloro-2-(2,5-dibromothiophen-3-yl)-7-fluoroquinazoline |
|---|---|
| PubChem CID | 107960345 |
| Molecular Formula | C12H4Br2ClFN2S |
| Molecular Weight | 422.50 g/mol |
| Exact Mass | 419.81 |
| IUPAC Name | 4-chloro-2-(2,5-dibromothiophen-3-yl)-7-fluoroquinazoline |
| SMILES | Fc1ccc2c(Cl)nc(-c3cc(Br)sc3Br)nc2c1 |
| InChI | InChI=1S/C12H4Br2ClFN2S/c13-9-4-7(10(14)19-9)12-17-8-3-5(16)1-2-6(8)11(15)18-12/h1-4H |
| InChIKey | IBRZGEKZWAOOOH-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.50 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |