About 4-chloro-2-(2,5-dibromothiophen-3-yl)-6-nitroquinazoline
4-chloro-2-(2,5-dibromothiophen-3-yl)-6-nitroquinazoline (PubChem CID 107960357) has the molecular formula C12H4Br2ClN3O2S
and a molecular weight of 449.51 g/mol. Its IUPAC name is 4-chloro-2-(2,5-dibromothiophen-3-yl)-6-nitroquinazoline.
Molecular Properties
| Compound Name | 4-chloro-2-(2,5-dibromothiophen-3-yl)-6-nitroquinazoline |
| PubChem CID | 107960357 |
| Molecular Formula | C12H4Br2ClN3O2S |
| Molecular Weight | 449.51 g/mol |
| Exact Mass | 446.81 |
| IUPAC Name | 4-chloro-2-(2,5-dibromothiophen-3-yl)-6-nitroquinazoline |
| SMILES | O=[N+]([O-])c1ccc2nc(-c3cc(Br)sc3Br)nc(Cl)c2c1 |
| InChI | InChI=1S/C12H4Br2ClN3O2S/c13-9-4-7(10(14)21-9)12-16-8-2-1-5(18(19)20)3-6(8)11(15)17-12/h1-4H |
| InChIKey | RWRVSJDEOPCPNI-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 68.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 449.51 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-chloro-2-(2,5-dibromothiophen-3-yl)-6-nitroquinazoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-2-(2,5-dibromothiophen-3-yl)-6-nitroquinazoline?
The IUPAC name of 4-chloro-2-(2,5-dibromothiophen-3-yl)-6-nitroquinazoline (CID 107960357) is 4-chloro-2-(2,5-dibromothiophen-3-yl)-6-nitroquinazoline.
What is the SMILES notation for 4-chloro-2-(2,5-dibromothiophen-3-yl)-6-nitroquinazoline?
The canonical SMILES for 4-chloro-2-(2,5-dibromothiophen-3-yl)-6-nitroquinazoline is O=[N+]([O-])c1ccc2nc(-c3cc(Br)sc3Br)nc(Cl)c2c1.
What is the InChIKey of 4-chloro-2-(2,5-dibromothiophen-3-yl)-6-nitroquinazoline?
The InChIKey is RWRVSJDEOPCPNI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H4Br2ClN3O2S/c13-9-4-7(10(14)21-9)12-16-8-2-1-5(18(19)20)3-6(8)11(15)17-12/h1-4H.
What are the key properties of 4-chloro-2-(2,5-dibromothiophen-3-yl)-6-nitroquinazoline?
4-chloro-2-(2,5-dibromothiophen-3-yl)-6-nitroquinazoline has a molecular weight of 449.51 g/mol, XLogP of 5.44, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-2-(2,5-dibromothiophen-3-yl)-6-nitroquinazoline is sourced from PubChem (CID 107960357), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).