C16H22BrNS2 — CID 107961246
N-[(5-bromothiophen-3-yl)-(5-tert-butylthiophen-2-yl)methyl]propan-1-amine (PubChem CID 107961246) has the molecular formula C16H22BrNS2 and a molecular weight of 372.40 g/mol. Its IUPAC name is N-[(5-bromothiophen-3-yl)-(5-tert-butylthiophen-2-yl)methyl]propan-1-amine.
| Compound Name | N-[(5-bromothiophen-3-yl)-(5-tert-butylthiophen-2-yl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 107961246 |
| Molecular Formula | C16H22BrNS2 |
| Molecular Weight | 372.40 g/mol |
| Exact Mass | 371.04 |
| IUPAC Name | N-[(5-bromothiophen-3-yl)-(5-tert-butylthiophen-2-yl)methyl]propan-1-amine |
| SMILES | CCCNC(c1csc(Br)c1)c1ccc(C(C)(C)C)s1 |
| InChI | InChI=1S/C16H22BrNS2/c1-5-8-18-15(11-9-14(17)19-10-11)12-6-7-13(20-12)16(2,3)4/h6-7,9-10,15,18H,5,8H2,1-4H3 |
| InChIKey | UMAXKMYZXRTGSI-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.40 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |