C18H24BrNS — CID 107960815
N-[(5-bromothiophen-3-yl)-(4-butan-2-ylphenyl)methyl]propan-1-amine (PubChem CID 107960815) has the molecular formula C18H24BrNS and a molecular weight of 366.37 g/mol. Its IUPAC name is N-[(5-bromothiophen-3-yl)-(4-butan-2-ylphenyl)methyl]propan-1-amine.
| Compound Name | N-[(5-bromothiophen-3-yl)-(4-butan-2-ylphenyl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 107960815 |
| Molecular Formula | C18H24BrNS |
| Molecular Weight | 366.37 g/mol |
| Exact Mass | 365.08 |
| IUPAC Name | N-[(5-bromothiophen-3-yl)-(4-butan-2-ylphenyl)methyl]propan-1-amine |
| SMILES | CCCNC(c1ccc(C(C)CC)cc1)c1csc(Br)c1 |
| InChI | InChI=1S/C18H24BrNS/c1-4-10-20-18(16-11-17(19)21-12-16)15-8-6-14(7-9-15)13(3)5-2/h6-9,11-13,18,20H,4-5,10H2,1-3H3 |
| InChIKey | QBWYMHDUSVYFJV-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.37 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |