C18H24BrNO — CID 43495744
N-[(5-bromofuran-2-yl)-(4-butan-2-ylphenyl)methyl]propan-1-amine (PubChem CID 43495744) has the molecular formula C18H24BrNO and a molecular weight of 350.30 g/mol. Its IUPAC name is N-[(5-bromofuran-2-yl)-(4-butan-2-ylphenyl)methyl]propan-1-amine.
| Compound Name | N-[(5-bromofuran-2-yl)-(4-butan-2-ylphenyl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 43495744 |
| Molecular Formula | C18H24BrNO |
| Molecular Weight | 350.30 g/mol |
| Exact Mass | 349.10 |
| IUPAC Name | N-[(5-bromofuran-2-yl)-(4-butan-2-ylphenyl)methyl]propan-1-amine |
| SMILES | CCCNC(c1ccc(C(C)CC)cc1)c1ccc(Br)o1 |
| InChI | InChI=1S/C18H24BrNO/c1-4-12-20-18(16-10-11-17(19)21-16)15-8-6-14(7-9-15)13(3)5-2/h6-11,13,18,20H,4-5,12H2,1-3H3 |
| InChIKey | NKOKAOVEFDTNOZ-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.30 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |