C14H12Br2N2OS2 — CID 107961783
2,5-dibromo-N-[(3-carbamothioylphenyl)methyl]-N-methylthiophene-3-carboxamide (PubChem CID 107961783) has the molecular formula C14H12Br2N2OS2 and a molecular weight of 448.21 g/mol. Its IUPAC name is 2,5-dibromo-N-[(3-carbamothioylphenyl)methyl]-N-methylthiophene-3-carboxamide.
| Compound Name | 2,5-dibromo-N-[(3-carbamothioylphenyl)methyl]-N-methylthiophene-3-carboxamide |
|---|---|
| PubChem CID | 107961783 |
| Molecular Formula | C14H12Br2N2OS2 |
| Molecular Weight | 448.21 g/mol |
| Exact Mass | 445.88 |
| IUPAC Name | 2,5-dibromo-N-[(3-carbamothioylphenyl)methyl]-N-methylthiophene-3-carboxamide |
| SMILES | CN(Cc1cccc(C(N)=S)c1)C(=O)c1cc(Br)sc1Br |
| InChI | InChI=1S/C14H12Br2N2OS2/c1-18(14(19)10-6-11(15)21-12(10)16)7-8-3-2-4-9(5-8)13(17)20/h2-6H,7H2,1H3,(H2,17,20) |
| InChIKey | PSGBINOGPCYHPS-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.21 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|