C16H18N2OS2 — CID 65239101
N-[(3-carbamothioylphenyl)methyl]-N,4,5-trimethylthiophene-2-carboxamide (PubChem CID 65239101) has the molecular formula C16H18N2OS2 and a molecular weight of 318.47 g/mol. Its IUPAC name is N-[(3-carbamothioylphenyl)methyl]-N,4,5-trimethylthiophene-2-carboxamide.
| Compound Name | N-[(3-carbamothioylphenyl)methyl]-N,4,5-trimethylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 65239101 |
| Molecular Formula | C16H18N2OS2 |
| Molecular Weight | 318.47 g/mol |
| Exact Mass | 318.09 |
| IUPAC Name | N-[(3-carbamothioylphenyl)methyl]-N,4,5-trimethylthiophene-2-carboxamide |
| SMILES | Cc1cc(C(=O)N(C)Cc2cccc(C(N)=S)c2)sc1C |
| InChI | InChI=1S/C16H18N2OS2/c1-10-7-14(21-11(10)2)16(19)18(3)9-12-5-4-6-13(8-12)15(17)20/h4-8H,9H2,1-3H3,(H2,17,20) |
| InChIKey | PLKZSCTZXXHQKF-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.47 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|