C12H16Br2N2OS — CID 107962323
2,5-dibromo-N-(2,6-dimethylpiperidin-1-yl)thiophene-3-carboxamide (PubChem CID 107962323) has the molecular formula C12H16Br2N2OS and a molecular weight of 396.15 g/mol. Its IUPAC name is 2,5-dibromo-N-(2,6-dimethylpiperidin-1-yl)thiophene-3-carboxamide.
| Compound Name | 2,5-dibromo-N-(2,6-dimethylpiperidin-1-yl)thiophene-3-carboxamide |
|---|---|
| PubChem CID | 107962323 |
| Molecular Formula | C12H16Br2N2OS |
| Molecular Weight | 396.15 g/mol |
| Exact Mass | 393.94 |
| IUPAC Name | 2,5-dibromo-N-(2,6-dimethylpiperidin-1-yl)thiophene-3-carboxamide |
| SMILES | CC1CCCC(C)N1NC(=O)c1cc(Br)sc1Br |
| InChI | InChI=1S/C12H16Br2N2OS/c1-7-4-3-5-8(2)16(7)15-12(17)9-6-10(13)18-11(9)14/h6-8H,3-5H2,1-2H3,(H,15,17) |
| InChIKey | DRVDLJSAKODJCL-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.15 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |