C15H22N2O3 — CID 115279910
N-(2,6-dimethylpiperidin-1-yl)-2-hydroxy-5-methoxybenzamide (PubChem CID 115279910) has the molecular formula C15H22N2O3 and a molecular weight of 278.35 g/mol. Its IUPAC name is N-(2,6-dimethylpiperidin-1-yl)-2-hydroxy-5-methoxybenzamide.
| Compound Name | N-(2,6-dimethylpiperidin-1-yl)-2-hydroxy-5-methoxybenzamide |
|---|---|
| PubChem CID | 115279910 |
| Molecular Formula | C15H22N2O3 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.16 |
| IUPAC Name | N-(2,6-dimethylpiperidin-1-yl)-2-hydroxy-5-methoxybenzamide |
| SMILES | COc1ccc(O)c(C(=O)NN2C(C)CCCC2C)c1 |
| InChI | InChI=1S/C15H22N2O3/c1-10-5-4-6-11(2)17(10)16-15(19)13-9-12(20-3)7-8-14(13)18/h7-11,18H,4-6H2,1-3H3,(H,16,19) |
| InChIKey | JEJCAVPDLHVCBP-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |