C12H14Br2N2O2S — CID 107962416
(2,5-dibromothiophen-3-yl)-[(4E)-3-ethyl-4-hydroxyiminopiperidin-1-yl]methanone (PubChem CID 107962416) has the molecular formula C12H14Br2N2O2S and a molecular weight of 410.13 g/mol. Its IUPAC name is (2,5-dibromothiophen-3-yl)-[(4E)-3-ethyl-4-hydroxyiminopiperidin-1-yl]methanone.
| Compound Name | (2,5-dibromothiophen-3-yl)-[(4E)-3-ethyl-4-hydroxyiminopiperidin-1-yl]methanone |
|---|---|
| PubChem CID | 107962416 |
| Molecular Formula | C12H14Br2N2O2S |
| Molecular Weight | 410.13 g/mol |
| Exact Mass | 407.91 |
| IUPAC Name | (2,5-dibromothiophen-3-yl)-[(4E)-3-ethyl-4-hydroxyiminopiperidin-1-yl]methanone |
| SMILES | CCC1CN(C(=O)c2cc(Br)sc2Br)CC/C1=N\O |
| InChI | InChI=1S/C12H14Br2N2O2S/c1-2-7-6-16(4-3-9(7)15-18)12(17)8-5-10(13)19-11(8)14/h5,7,18H,2-4,6H2,1H3/b15-9+ |
| InChIKey | KXOBSJGKMBPUFX-OQLLNIDSSA-N |
| XLogP | 3.98 |
| TPSA | 52.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.13 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|