C14H16Br2N2O2 — CID 107972408
(3,5-dibromophenyl)-[(4E)-3-ethyl-4-hydroxyiminopiperidin-1-yl]methanone (PubChem CID 107972408) has the molecular formula C14H16Br2N2O2 and a molecular weight of 404.10 g/mol. Its IUPAC name is (3,5-dibromophenyl)-[(4E)-3-ethyl-4-hydroxyiminopiperidin-1-yl]methanone.
| Compound Name | (3,5-dibromophenyl)-[(4E)-3-ethyl-4-hydroxyiminopiperidin-1-yl]methanone |
|---|---|
| PubChem CID | 107972408 |
| Molecular Formula | C14H16Br2N2O2 |
| Molecular Weight | 404.10 g/mol |
| Exact Mass | 401.96 |
| IUPAC Name | (3,5-dibromophenyl)-[(4E)-3-ethyl-4-hydroxyiminopiperidin-1-yl]methanone |
| SMILES | CCC1CN(C(=O)c2cc(Br)cc(Br)c2)CC/C1=N\O |
| InChI | InChI=1S/C14H16Br2N2O2/c1-2-9-8-18(4-3-13(9)17-20)14(19)10-5-11(15)7-12(16)6-10/h5-7,9,20H,2-4,8H2,1H3/b17-13+ |
| InChIKey | WQMLSAJAGQCJQF-GHRIWEEISA-N |
| XLogP | 3.91 |
| TPSA | 52.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.10 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|