C14H10BrN3O2S — CID 107962597
4-(1,3-benzodioxol-5-yl)-5-(5-bromothiophen-3-yl)-1H-pyrazol-3-amine (PubChem CID 107962597) has the molecular formula C14H10BrN3O2S and a molecular weight of 364.22 g/mol. Its IUPAC name is 4-(1,3-benzodioxol-5-yl)-5-(5-bromothiophen-3-yl)-1H-pyrazol-3-amine.
| Compound Name | 4-(1,3-benzodioxol-5-yl)-5-(5-bromothiophen-3-yl)-1H-pyrazol-3-amine |
|---|---|
| PubChem CID | 107962597 |
| Molecular Formula | C14H10BrN3O2S |
| Molecular Weight | 364.22 g/mol |
| Exact Mass | 362.97 |
| IUPAC Name | 4-(1,3-benzodioxol-5-yl)-5-(5-bromothiophen-3-yl)-1H-pyrazol-3-amine |
| SMILES | Nc1n[nH]c(-c2csc(Br)c2)c1-c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C14H10BrN3O2S/c15-11-4-8(5-21-11)13-12(14(16)18-17-13)7-1-2-9-10(3-7)20-6-19-9/h1-5H,6H2,(H3,16,17,18) |
| InChIKey | QWCHCTKOIVKEPJ-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 73.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.22 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |