C10H6Br2OS2 — CID 107962768
1-(2,5-dibromothiophen-3-yl)-2-thiophen-2-ylethanone (PubChem CID 107962768) has the molecular formula C10H6Br2OS2 and a molecular weight of 366.10 g/mol. Its IUPAC name is 1-(2,5-dibromothiophen-3-yl)-2-thiophen-2-ylethanone.
| Compound Name | 1-(2,5-dibromothiophen-3-yl)-2-thiophen-2-ylethanone |
|---|---|
| PubChem CID | 107962768 |
| Molecular Formula | C10H6Br2OS2 |
| Molecular Weight | 366.10 g/mol |
| Exact Mass | 363.82 |
| IUPAC Name | 1-(2,5-dibromothiophen-3-yl)-2-thiophen-2-ylethanone |
| SMILES | O=C(Cc1cccs1)c1cc(Br)sc1Br |
| InChI | InChI=1S/C10H6Br2OS2/c11-9-5-7(10(12)15-9)8(13)4-6-2-1-3-14-6/h1-3,5H,4H2 |
| InChIKey | WMYGUWQFHGNWKP-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.10 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |