C12H16BrClN2OS — CID 107965875
(5-bromothiophen-3-yl)-[4-(2-chloroethyl)-1,4-diazepan-1-yl]methanone (PubChem CID 107965875) has the molecular formula C12H16BrClN2OS and a molecular weight of 351.70 g/mol. Its IUPAC name is (5-bromothiophen-3-yl)-[4-(2-chloroethyl)-1,4-diazepan-1-yl]methanone.
| Compound Name | (5-bromothiophen-3-yl)-[4-(2-chloroethyl)-1,4-diazepan-1-yl]methanone |
|---|---|
| PubChem CID | 107965875 |
| Molecular Formula | C12H16BrClN2OS |
| Molecular Weight | 351.70 g/mol |
| Exact Mass | 349.99 |
| IUPAC Name | (5-bromothiophen-3-yl)-[4-(2-chloroethyl)-1,4-diazepan-1-yl]methanone |
| SMILES | O=C(c1csc(Br)c1)N1CCCN(CCCl)CC1 |
| InChI | InChI=1S/C12H16BrClN2OS/c13-11-8-10(9-18-11)12(17)16-4-1-3-15(5-2-14)6-7-16/h8-9H,1-7H2 |
| InChIKey | YFKMVCJGQSMZMT-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.70 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|