C12H15Br2ClN2OS — CID 114021796
[4-(2-chloroethyl)-1,4-diazepan-1-yl]-(2,5-dibromothiophen-3-yl)methanone (PubChem CID 114021796) has the molecular formula C12H15Br2ClN2OS and a molecular weight of 430.59 g/mol. Its IUPAC name is [4-(2-chloroethyl)-1,4-diazepan-1-yl]-(2,5-dibromothiophen-3-yl)methanone.
| Compound Name | [4-(2-chloroethyl)-1,4-diazepan-1-yl]-(2,5-dibromothiophen-3-yl)methanone |
|---|---|
| PubChem CID | 114021796 |
| Molecular Formula | C12H15Br2ClN2OS |
| Molecular Weight | 430.59 g/mol |
| Exact Mass | 427.90 |
| IUPAC Name | [4-(2-chloroethyl)-1,4-diazepan-1-yl]-(2,5-dibromothiophen-3-yl)methanone |
| SMILES | O=C(c1cc(Br)sc1Br)N1CCCN(CCCl)CC1 |
| InChI | InChI=1S/C12H15Br2ClN2OS/c13-10-8-9(11(14)19-10)12(18)17-4-1-3-16(5-2-15)6-7-17/h8H,1-7H2 |
| InChIKey | FNZPRYNSFADMFS-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.59 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|