C11H12Cl2N4O2S — CID 107967073
2-[5-(2,5-dichlorothiophen-3-yl)tetrazol-1-yl]-2-ethylbutanoic acid (PubChem CID 107967073) has the molecular formula C11H12Cl2N4O2S and a molecular weight of 335.22 g/mol. Its IUPAC name is 2-[5-(2,5-dichlorothiophen-3-yl)tetrazol-1-yl]-2-ethylbutanoic acid.
| Compound Name | 2-[5-(2,5-dichlorothiophen-3-yl)tetrazol-1-yl]-2-ethylbutanoic acid |
|---|---|
| PubChem CID | 107967073 |
| Molecular Formula | C11H12Cl2N4O2S |
| Molecular Weight | 335.22 g/mol |
| Exact Mass | 334.01 |
| IUPAC Name | 2-[5-(2,5-dichlorothiophen-3-yl)tetrazol-1-yl]-2-ethylbutanoic acid |
| SMILES | CCC(CC)(C(=O)O)n1nnnc1-c1cc(Cl)sc1Cl |
| InChI | InChI=1S/C11H12Cl2N4O2S/c1-3-11(4-2,10(18)19)17-9(14-15-16-17)6-5-7(12)20-8(6)13/h5H,3-4H2,1-2H3,(H,18,19) |
| InChIKey | IRFOFXPZCJMWED-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.22 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |