C8H6Cl2N4O2S — CID 107967056
2-[5-(2,5-dichlorothiophen-3-yl)tetrazol-1-yl]propanoic acid (PubChem CID 107967056) has the molecular formula C8H6Cl2N4O2S and a molecular weight of 293.14 g/mol. Its IUPAC name is 2-[5-(2,5-dichlorothiophen-3-yl)tetrazol-1-yl]propanoic acid.
| Compound Name | 2-[5-(2,5-dichlorothiophen-3-yl)tetrazol-1-yl]propanoic acid |
|---|---|
| PubChem CID | 107967056 |
| Molecular Formula | C8H6Cl2N4O2S |
| Molecular Weight | 293.14 g/mol |
| Exact Mass | 291.96 |
| IUPAC Name | 2-[5-(2,5-dichlorothiophen-3-yl)tetrazol-1-yl]propanoic acid |
| SMILES | CC(C(=O)O)n1nnnc1-c1cc(Cl)sc1Cl |
| InChI | InChI=1S/C8H6Cl2N4O2S/c1-3(8(15)16)14-7(11-12-13-14)4-2-5(9)17-6(4)10/h2-3H,1H3,(H,15,16) |
| InChIKey | ZZPVZCTWHHEOFG-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.14 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |