C8H12O — CID 10796741
(2R,3R)-2-butyl-3-ethynyloxirane (PubChem CID 10796741) has the molecular formula C8H12O and a molecular weight of 124.18 g/mol. Its IUPAC name is (2R,3R)-2-butyl-3-ethynyloxirane.
| Compound Name | (2R,3R)-2-butyl-3-ethynyloxirane |
|---|---|
| PubChem CID | 10796741 |
| Molecular Formula | C8H12O |
| Molecular Weight | 124.18 g/mol |
| Exact Mass | 124.09 |
| IUPAC Name | (2R,3R)-2-butyl-3-ethynyloxirane |
| SMILES | C#C[C@H]1O[C@@H]1CCCC |
| InChI | InChI=1S/C8H12O/c1-3-5-6-8-7(4-2)9-8/h2,7-8H,3,5-6H2,1H3/t7-,8-/m1/s1 |
| InChIKey | SNULCQAVKCLNTD-HTQZYQBOSA-N |
| XLogP | 1.58 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 124.18 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|