C14H13Cl2N3S — CID 107968554
1-(2,5-dichlorothiophen-3-yl)-2-(1-methylindazol-3-yl)ethanamine (PubChem CID 107968554) has the molecular formula C14H13Cl2N3S and a molecular weight of 326.25 g/mol. Its IUPAC name is 1-(2,5-dichlorothiophen-3-yl)-2-(1-methylindazol-3-yl)ethanamine.
| Compound Name | 1-(2,5-dichlorothiophen-3-yl)-2-(1-methylindazol-3-yl)ethanamine |
|---|---|
| PubChem CID | 107968554 |
| Molecular Formula | C14H13Cl2N3S |
| Molecular Weight | 326.25 g/mol |
| Exact Mass | 325.02 |
| IUPAC Name | 1-(2,5-dichlorothiophen-3-yl)-2-(1-methylindazol-3-yl)ethanamine |
| SMILES | Cn1nc(CC(N)c2cc(Cl)sc2Cl)c2ccccc21 |
| InChI | InChI=1S/C14H13Cl2N3S/c1-19-12-5-3-2-4-8(12)11(18-19)7-10(17)9-6-13(15)20-14(9)16/h2-6,10H,7,17H2,1H3 |
| InChIKey | HTWCSPJPGUTXQC-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.25 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |